C17H18F3N5O5S2 — CID 71715212
[(1R,2R,3S,4R)-2,3-dihydroxy-4-[[2-[5-(trifluoromethyl)thiophen-2-yl]pyrazolo[1,5-a]pyrimidin-7-yl]amino]cyclopentyl]methyl sulfamate (PubChem CID 71715212) has the molecular formula C17H18F3N5O5S2 and a molecular weight of 493.49 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-2,3-dihydroxy-4-[[2-[5-(trifluoromethyl)thiophen-2-yl]pyrazolo[1,5-a]pyrimidin-7-yl]amino]cyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2R,3S,4R)-2,3-dihydroxy-4-[[2-[5-(trifluoromethyl)thiophen-2-yl]pyrazolo[1,5-a]pyrimidin-7-yl]amino]cyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 71715212 |
| Molecular Formula | C17H18F3N5O5S2 |
| Molecular Weight | 493.49 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | [(1R,2R,3S,4R)-2,3-dihydroxy-4-[[2-[5-(trifluoromethyl)thiophen-2-yl]pyrazolo[1,5-a]pyrimidin-7-yl]amino]cyclopentyl]methyl sulfamate |
| SMILES | NS(=O)(=O)OC[C@H]1C[C@@H](Nc2ccnc3cc(-c4ccc(C(F)(F)F)s4)nn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H18F3N5O5S2/c18-17(19,20)12-2-1-11(31-12)9-6-14-22-4-3-13(25(14)24-9)23-10-5-8(15(26)16(10)27)7-30-32(21,28)29/h1-4,6,8,10,15-16,23,26-27H,5,7H2,(H2,21,28,29)/t8-,10-,15-,16+/m1/s1 |
| InChIKey | OLUBTRMMTMIAJS-UZBOYFSQSA-N |
| XLogP | 1.22 |
| TPSA | 152.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.49 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |