C19H21F2N5O6S — CID 71715432
[(1R,2R,3S,4R)-4-[[2-[3-(difluoromethoxy)phenyl]pyrazolo[1,5-a]pyrimidin-7-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate (PubChem CID 71715432) has the molecular formula C19H21F2N5O6S and a molecular weight of 485.47 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-4-[[2-[3-(difluoromethoxy)phenyl]pyrazolo[1,5-a]pyrimidin-7-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2R,3S,4R)-4-[[2-[3-(difluoromethoxy)phenyl]pyrazolo[1,5-a]pyrimidin-7-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 71715432 |
| Molecular Formula | C19H21F2N5O6S |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | [(1R,2R,3S,4R)-4-[[2-[3-(difluoromethoxy)phenyl]pyrazolo[1,5-a]pyrimidin-7-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate |
| SMILES | NS(=O)(=O)OC[C@H]1C[C@@H](Nc2ccnc3cc(-c4cccc(OC(F)F)c4)nn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H21F2N5O6S/c20-19(21)32-12-3-1-2-10(6-12)13-8-16-23-5-4-15(26(16)25-13)24-14-7-11(17(27)18(14)28)9-31-33(22,29)30/h1-6,8,11,14,17-19,24,27-28H,7,9H2,(H2,22,29,30)/t11-,14-,17-,18+/m1/s1 |
| InChIKey | OODUIKDGEIMJMH-DGWLBADLSA-N |
| XLogP | 0.74 |
| TPSA | 161.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |