C30H30N4O2S — CID 71715500
N-[[(1S,3aS,7aS)-2-(2-methyl-4-phenyl-1,3-thiazole-5-carbonyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-1-yl]methyl]quinoline-8-carboxamide (PubChem CID 71715500) has the molecular formula C30H30N4O2S and a molecular weight of 510.66 g/mol. Its IUPAC name is N-[[(1S,3aS,7aS)-2-(2-methyl-4-phenyl-1,3-thiazole-5-carbonyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-1-yl]methyl]quinoline-8-carboxamide.
| Compound Name | N-[[(1S,3aS,7aS)-2-(2-methyl-4-phenyl-1,3-thiazole-5-carbonyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-1-yl]methyl]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 71715500 |
| Molecular Formula | C30H30N4O2S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | N-[[(1S,3aS,7aS)-2-(2-methyl-4-phenyl-1,3-thiazole-5-carbonyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-1-yl]methyl]quinoline-8-carboxamide |
| SMILES | Cc1nc(-c2ccccc2)c(C(=O)N2C[C@H]3CCCC[C@@H]3[C@H]2CNC(=O)c2cccc3cccnc23)s1 |
| InChI | InChI=1S/C30H30N4O2S/c1-19-33-27(21-9-3-2-4-10-21)28(37-19)30(36)34-18-22-11-5-6-14-23(22)25(34)17-32-29(35)24-15-7-12-20-13-8-16-31-26(20)24/h2-4,7-10,12-13,15-16,22-23,25H,5-6,11,14,17-18H2,1H3,(H,32,35)/t22-,23+,25-/m1/s1 |
| InChIKey | UIXGWGUSLZNLNP-GIFXNVAJSA-N |
| XLogP | 5.73 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |