C22H28N4O4 — CID 71715524
N-[[6-[2-(tert-butylamino)-2-oxoacetyl]-6-azaspiro[2.5]octan-2-yl]methyl]furo[2,3-c]pyridine-2-carboxamide (PubChem CID 71715524) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-[[6-[2-(tert-butylamino)-2-oxoacetyl]-6-azaspiro[2.5]octan-2-yl]methyl]furo[2,3-c]pyridine-2-carboxamide.
| Compound Name | N-[[6-[2-(tert-butylamino)-2-oxoacetyl]-6-azaspiro[2.5]octan-2-yl]methyl]furo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 71715524 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | N-[[6-[2-(tert-butylamino)-2-oxoacetyl]-6-azaspiro[2.5]octan-2-yl]methyl]furo[2,3-c]pyridine-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)C(=O)N1CCC2(CC1)CC2CNC(=O)c1cc2ccncc2o1 |
| InChI | InChI=1S/C22H28N4O4/c1-21(2,3)25-19(28)20(29)26-8-5-22(6-9-26)11-15(22)12-24-18(27)16-10-14-4-7-23-13-17(14)30-16/h4,7,10,13,15H,5-6,8-9,11-12H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | FFWDOOFDXSCCFH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|