C24H25FN4O3 — CID 71715559
3-[(cyclopropanecarbonylamino)methyl]-9-fluoro-10-(3-hydroxy-3-methylbut-1-ynyl)-5,6,7,12-tetrahydro-5,7-methanobenzo[c]imidazo[1,2-a]azepine-2-carboxamide (PubChem CID 71715559) has the molecular formula C24H25FN4O3 and a molecular weight of 436.49 g/mol. Its IUPAC name is 3-[(cyclopropanecarbonylamino)methyl]-9-fluoro-10-(3-hydroxy-3-methylbut-1-ynyl)-5,6,7,12-tetrahydro-5,7-methanobenzo[c]imidazo[1,2-a]azepine-2-carboxamide.
| Compound Name | 3-[(cyclopropanecarbonylamino)methyl]-9-fluoro-10-(3-hydroxy-3-methylbut-1-ynyl)-5,6,7,12-tetrahydro-5,7-methanobenzo[c]imidazo[1,2-a]azepine-2-carboxamide |
|---|---|
| PubChem CID | 71715559 |
| Molecular Formula | C24H25FN4O3 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 3-[(cyclopropanecarbonylamino)methyl]-9-fluoro-10-(3-hydroxy-3-methylbut-1-ynyl)-5,6,7,12-tetrahydro-5,7-methanobenzo[c]imidazo[1,2-a]azepine-2-carboxamide |
| SMILES | CC(C)(O)C#Cc1cc2c(cc1F)C1CC(C1)n1c-2nc(C(N)=O)c1CNC(=O)C1CC1 |
| InChI | InChI=1S/C24H25FN4O3/c1-24(2,32)6-5-13-9-17-16(10-18(13)25)14-7-15(8-14)29-19(11-27-23(31)12-3-4-12)20(21(26)30)28-22(17)29/h9-10,12,14-15,32H,3-4,7-8,11H2,1-2H3,(H2,26,30)(H,27,31) |
| InChIKey | IHWRBNJFVZJBQM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|