C25H30F6N4O5S — CID 71715640
2-[4-[(2S)-4-[(6-amino-3-pyridinyl)sulfonyl]-2-[[4-(hydroxymethyl)oxan-4-yl]methyl]piperazin-1-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 71715640) has the molecular formula C25H30F6N4O5S and a molecular weight of 612.59 g/mol. Its IUPAC name is 2-[4-[(2S)-4-[(6-amino-3-pyridinyl)sulfonyl]-2-[[4-(hydroxymethyl)oxan-4-yl]methyl]piperazin-1-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[(2S)-4-[(6-amino-3-pyridinyl)sulfonyl]-2-[[4-(hydroxymethyl)oxan-4-yl]methyl]piperazin-1-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 71715640 |
| Molecular Formula | C25H30F6N4O5S |
| Molecular Weight | 612.59 g/mol |
| Exact Mass | 612.18 |
| IUPAC Name | 2-[4-[(2S)-4-[(6-amino-3-pyridinyl)sulfonyl]-2-[[4-(hydroxymethyl)oxan-4-yl]methyl]piperazin-1-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Nc1ccc(S(=O)(=O)N2CCN(c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)[C@@H](CC3(CO)CCOCC3)C2)cn1 |
| InChI | InChI=1S/C25H30F6N4O5S/c26-24(27,28)23(37,25(29,30)31)17-1-3-18(4-2-17)35-10-9-34(41(38,39)20-5-6-21(32)33-14-20)15-19(35)13-22(16-36)7-11-40-12-8-22/h1-6,14,19,36-37H,7-13,15-16H2,(H2,32,33)/t19-/m0/s1 |
| InChIKey | GZJHQWOWOBTVRE-IBGZPJMESA-N |
| XLogP | 3.03 |
| TPSA | 129.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.59 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|