C20H20ClN5O5S2 — CID 71715654
[(1R,2R,3S,4R)-4-[[2-(6-chloro-1-benzothiophen-2-yl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate (PubChem CID 71715654) has the molecular formula C20H20ClN5O5S2 and a molecular weight of 510.00 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-4-[[2-(6-chloro-1-benzothiophen-2-yl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2R,3S,4R)-4-[[2-(6-chloro-1-benzothiophen-2-yl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 71715654 |
| Molecular Formula | C20H20ClN5O5S2 |
| Molecular Weight | 510.00 g/mol |
| Exact Mass | 509.06 |
| IUPAC Name | [(1R,2R,3S,4R)-4-[[2-(6-chloro-1-benzothiophen-2-yl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate |
| SMILES | NS(=O)(=O)OC[C@H]1C[C@@H](Nc2ccnc3cc(-c4cc5ccc(Cl)cc5s4)nn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H20ClN5O5S2/c21-12-2-1-10-6-16(32-15(10)7-12)13-8-18-23-4-3-17(26(18)25-13)24-14-5-11(19(27)20(14)28)9-31-33(22,29)30/h1-4,6-8,11,14,19-20,24,27-28H,5,9H2,(H2,22,29,30)/t11-,14-,19-,20+/m1/s1 |
| InChIKey | GOIILOFEIUREBR-VQHIELQLSA-N |
| XLogP | 2.01 |
| TPSA | 152.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.00 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |