C33H27F3N2O4S — CID 71715689
1-benzyl-2-(1-benzyl-5-methoxyindol-2-yl)-5-methoxy-3-(trifluoromethylsulfonyl)indole (PubChem CID 71715689) has the molecular formula C33H27F3N2O4S and a molecular weight of 604.65 g/mol. Its IUPAC name is 1-benzyl-2-(1-benzyl-5-methoxyindol-2-yl)-5-methoxy-3-(trifluoromethylsulfonyl)indole.
| Compound Name | 1-benzyl-2-(1-benzyl-5-methoxyindol-2-yl)-5-methoxy-3-(trifluoromethylsulfonyl)indole |
|---|---|
| PubChem CID | 71715689 |
| Molecular Formula | C33H27F3N2O4S |
| Molecular Weight | 604.65 g/mol |
| Exact Mass | 604.16 |
| IUPAC Name | 1-benzyl-2-(1-benzyl-5-methoxyindol-2-yl)-5-methoxy-3-(trifluoromethylsulfonyl)indole |
| SMILES | COc1ccc2c(c1)cc(-c1c(S(=O)(=O)C(F)(F)F)c3cc(OC)ccc3n1Cc1ccccc1)n2Cc1ccccc1 |
| InChI | InChI=1S/C33H27F3N2O4S/c1-41-25-13-15-28-24(17-25)18-30(37(28)20-22-9-5-3-6-10-22)31-32(43(39,40)33(34,35)36)27-19-26(42-2)14-16-29(27)38(31)21-23-11-7-4-8-12-23/h3-19H,20-21H2,1-2H3 |
| InChIKey | FFZYNECWBRWPHQ-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.65 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |