C22H22F6N4O3S — CID 71715871
2-[4-[4-[(6-amino-3-pyridinyl)sulfonyl]-2-but-1-ynylpiperazin-1-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 71715871) has the molecular formula C22H22F6N4O3S and a molecular weight of 536.50 g/mol. Its IUPAC name is 2-[4-[4-[(6-amino-3-pyridinyl)sulfonyl]-2-but-1-ynylpiperazin-1-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[4-[(6-amino-3-pyridinyl)sulfonyl]-2-but-1-ynylpiperazin-1-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 71715871 |
| Molecular Formula | C22H22F6N4O3S |
| Molecular Weight | 536.50 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | 2-[4-[4-[(6-amino-3-pyridinyl)sulfonyl]-2-but-1-ynylpiperazin-1-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCC#CC1CN(S(=O)(=O)c2ccc(N)nc2)CCN1c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H22F6N4O3S/c1-2-3-4-17-14-31(36(34,35)18-9-10-19(29)30-13-18)11-12-32(17)16-7-5-15(6-8-16)20(33,21(23,24)25)22(26,27)28/h5-10,13,17,33H,2,11-12,14H2,1H3,(H2,29,30) |
| InChIKey | TYNUBFMBHRHVLS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|