C15H20N2O — CID 71715934
1-(2-methylphenyl)-1,2,3,4,5,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-7-one (PubChem CID 71715934) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is 1-(2-methylphenyl)-1,2,3,4,5,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-7-one.
| Compound Name | 1-(2-methylphenyl)-1,2,3,4,5,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-7-one |
|---|---|
| PubChem CID | 71715934 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 1-(2-methylphenyl)-1,2,3,4,5,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-7-one |
| SMILES | Cc1ccccc1C1NCCCN2C(=O)CCC12 |
| InChI | InChI=1S/C15H20N2O/c1-11-5-2-3-6-12(11)15-13-7-8-14(18)17(13)10-4-9-16-15/h2-3,5-6,13,15-16H,4,7-10H2,1H3 |
| InChIKey | OTEPRPCLACJGJC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |