About (2R)-N,N-dimethyl-4-pyrazin-2-yloxybutan-2-amine
(2R)-N,N-dimethyl-4-pyrazin-2-yloxybutan-2-amine (PubChem CID 71716104) has the molecular formula C10H17N3O
and a molecular weight of 195.27 g/mol. Its IUPAC name is (2R)-N,N-dimethyl-4-pyrazin-2-yloxybutan-2-amine.
Molecular Properties
| Compound Name | (2R)-N,N-dimethyl-4-pyrazin-2-yloxybutan-2-amine |
| PubChem CID | 71716104 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | (2R)-N,N-dimethyl-4-pyrazin-2-yloxybutan-2-amine |
| SMILES | C[C@H](CCOc1cnccn1)N(C)C |
| InChI | InChI=1S/C10H17N3O/c1-9(13(2)3)4-7-14-10-8-11-5-6-12-10/h5-6,8-9H,4,7H2,1-3H3/t9-/m1/s1 |
| InChIKey | RQNVFRQAQKESBK-SECBINFHSA-N |
| XLogP | 1.20 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-N,N-dimethyl-4-pyrazin-2-yloxybutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N,N-dimethyl-4-pyrazin-2-yloxybutan-2-amine?
The IUPAC name of (2R)-N,N-dimethyl-4-pyrazin-2-yloxybutan-2-amine (CID 71716104) is (2R)-N,N-dimethyl-4-pyrazin-2-yloxybutan-2-amine.
What is the SMILES notation for (2R)-N,N-dimethyl-4-pyrazin-2-yloxybutan-2-amine?
The canonical SMILES for (2R)-N,N-dimethyl-4-pyrazin-2-yloxybutan-2-amine is C[C@H](CCOc1cnccn1)N(C)C.
What is the InChIKey of (2R)-N,N-dimethyl-4-pyrazin-2-yloxybutan-2-amine?
The InChIKey is RQNVFRQAQKESBK-SECBINFHSA-N. The full InChI is InChI=1S/C10H17N3O/c1-9(13(2)3)4-7-14-10-8-11-5-6-12-10/h5-6,8-9H,4,7H2,1-3H3/t9-/m1/s1.
What are the key properties of (2R)-N,N-dimethyl-4-pyrazin-2-yloxybutan-2-amine?
(2R)-N,N-dimethyl-4-pyrazin-2-yloxybutan-2-amine has a molecular weight of 195.27 g/mol, XLogP of 1.20, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N,N-dimethyl-4-pyrazin-2-yloxybutan-2-amine is sourced from PubChem (CID 71716104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).