About 1-[4-[2-cyano-4-(1,3-thiazol-2-ylsulfamoyl)phenoxy]phenyl]pyrazole-4-carboxamide
1-[4-[2-cyano-4-(1,3-thiazol-2-ylsulfamoyl)phenoxy]phenyl]pyrazole-4-carboxamide (PubChem CID 71716176) has the molecular formula C20H14N6O4S2
and a molecular weight of 466.50 g/mol. Its IUPAC name is 1-[4-[2-cyano-4-(1,3-thiazol-2-ylsulfamoyl)phenoxy]phenyl]pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 1-[4-[2-cyano-4-(1,3-thiazol-2-ylsulfamoyl)phenoxy]phenyl]pyrazole-4-carboxamide |
| PubChem CID | 71716176 |
| Molecular Formula | C20H14N6O4S2 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | 1-[4-[2-cyano-4-(1,3-thiazol-2-ylsulfamoyl)phenoxy]phenyl]pyrazole-4-carboxamide |
| SMILES | N#Cc1cc(S(=O)(=O)Nc2nccs2)ccc1Oc1ccc(-n2cc(C(N)=O)cn2)cc1 |
| InChI | InChI=1S/C20H14N6O4S2/c21-10-13-9-17(32(28,29)25-20-23-7-8-31-20)5-6-18(13)30-16-3-1-15(2-4-16)26-12-14(11-24-26)19(22)27/h1-9,11-12H,(H2,22,27)(H,23,25) |
| InChIKey | KGWSUOAVWCUQTE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 152.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 1-[4-[2-cyano-4-(1,3-thiazol-2-ylsulfamoyl)phenoxy]phenyl]pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[2-cyano-4-(1,3-thiazol-2-ylsulfamoyl)phenoxy]phenyl]pyrazole-4-carboxamide?
The IUPAC name of 1-[4-[2-cyano-4-(1,3-thiazol-2-ylsulfamoyl)phenoxy]phenyl]pyrazole-4-carboxamide (CID 71716176) is 1-[4-[2-cyano-4-(1,3-thiazol-2-ylsulfamoyl)phenoxy]phenyl]pyrazole-4-carboxamide.
What is the SMILES notation for 1-[4-[2-cyano-4-(1,3-thiazol-2-ylsulfamoyl)phenoxy]phenyl]pyrazole-4-carboxamide?
The canonical SMILES for 1-[4-[2-cyano-4-(1,3-thiazol-2-ylsulfamoyl)phenoxy]phenyl]pyrazole-4-carboxamide is N#Cc1cc(S(=O)(=O)Nc2nccs2)ccc1Oc1ccc(-n2cc(C(N)=O)cn2)cc1.
What is the InChIKey of 1-[4-[2-cyano-4-(1,3-thiazol-2-ylsulfamoyl)phenoxy]phenyl]pyrazole-4-carboxamide?
The InChIKey is KGWSUOAVWCUQTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N6O4S2/c21-10-13-9-17(32(28,29)25-20-23-7-8-31-20)5-6-18(13)30-16-3-1-15(2-4-16)26-12-14(11-24-26)19(22)27/h1-9,11-12H,(H2,22,27)(H,23,25).
What are the key properties of 1-[4-[2-cyano-4-(1,3-thiazol-2-ylsulfamoyl)phenoxy]phenyl]pyrazole-4-carboxamide?
1-[4-[2-cyano-4-(1,3-thiazol-2-ylsulfamoyl)phenoxy]phenyl]pyrazole-4-carboxamide has a molecular weight of 466.50 g/mol, XLogP of 2.89, 7 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[2-cyano-4-(1,3-thiazol-2-ylsulfamoyl)phenoxy]phenyl]pyrazole-4-carboxamide is sourced from PubChem (CID 71716176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).