C21H25NO — CID 7171632
(2S,3S,5R,6R)-3,5-dimethyl-2,6-bis(2-methylphenyl)piperidin-4-one (PubChem CID 7171632) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is (2S,3S,5R,6R)-3,5-dimethyl-2,6-bis(2-methylphenyl)piperidin-4-one.
| Compound Name | (2S,3S,5R,6R)-3,5-dimethyl-2,6-bis(2-methylphenyl)piperidin-4-one |
|---|---|
| PubChem CID | 7171632 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (2S,3S,5R,6R)-3,5-dimethyl-2,6-bis(2-methylphenyl)piperidin-4-one |
| SMILES | Cc1ccccc1[C@H]1N[C@@H](c2ccccc2C)[C@@H](C)C(=O)[C@H]1C |
| InChI | InChI=1S/C21H25NO/c1-13-9-5-7-11-17(13)19-15(3)21(23)16(4)20(22-19)18-12-8-6-10-14(18)2/h5-12,15-16,19-20,22H,1-4H3/t15-,16+,19-,20+ |
| InChIKey | GZFSBHPTKSDFKX-NFQUHZNNSA-N |
| XLogP | 4.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |