About CID 71716383
CID 71716383 (PubChem CID 71716383) has the molecular formula C45H43N5O4
and a molecular weight of 717.87 g/mol.
Molecular Properties
| Compound Name | CID 71716383 |
| PubChem CID | 71716383 |
| Molecular Formula | C45H43N5O4 |
| Molecular Weight | 717.87 g/mol |
| Exact Mass | 717.33 |
| IUPAC Name | — |
| SMILES | O=C(C[C@H]1C[C@H]2CCCN2[C@]12C(=O)Nc1ccccc12)N1C/C(=C\c2cccc3ccccc23)C(=O)[C@]2(C[C@H]3CCCN3[C@@]23C(=O)Nc2ccccc23)C1 |
| InChI | InChI=1S/C45H43N5O4/c51-39(24-31-23-32-13-8-20-49(32)44(31)35-16-3-5-18-37(35)46-41(44)53)48-26-30(22-29-12-7-11-28-10-1-2-15-34(28)29)40(52)43(27-48)25-33-14-9-21-50(33)45(43)36-17-4-6-19-38(36)47-42(45)54/h1-7,10-12,15-19,22,31-33H,8-9,13-14,20-21,23-27H2,(H,46,53)(H,47,54)/b30-22+/t31-,32-,33-,43+,44-,45+/m1/s1 |
| InChIKey | QJDKSLPODCPDIR-UZJWSWILSA-N |
| XLogP | 6.06 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 717.87 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 71716383 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71716383?
The IUPAC name of CID 71716383 (CID 71716383) is not available.
What is the SMILES notation for CID 71716383?
The canonical SMILES for CID 71716383 is O=C(C[C@H]1C[C@H]2CCCN2[C@]12C(=O)Nc1ccccc12)N1C/C(=C\c2cccc3ccccc23)C(=O)[C@]2(C[C@H]3CCCN3[C@@]23C(=O)Nc2ccccc23)C1.
What is the InChIKey of CID 71716383?
The InChIKey is QJDKSLPODCPDIR-UZJWSWILSA-N. The full InChI is InChI=1S/C45H43N5O4/c51-39(24-31-23-32-13-8-20-49(32)44(31)35-16-3-5-18-37(35)46-41(44)53)48-26-30(22-29-12-7-11-28-10-1-2-15-34(28)29)40(52)43(27-48)25-33-14-9-21-50(33)45(43)36-17-4-6-19-38(36)47-42(45)54/h1-7,10-12,15-19,22,31-33H,8-9,13-14,20-21,23-27H2,(H,46,53)(H,47,54)/b30-22+/t31-,32-,33-,43+,44-,45+/m1/s1.
What are the key properties of CID 71716383?
CID 71716383 has a molecular weight of 717.87 g/mol, XLogP of 6.06, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71716383 is sourced from PubChem (CID 71716383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).