C25H30N10O6S — CID 71716414
2-[[(2R)-2-[[2-[[5-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-1H-pyrazole-3-carbonyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid (PubChem CID 71716414) has the molecular formula C25H30N10O6S and a molecular weight of 598.65 g/mol. Its IUPAC name is 2-[[(2R)-2-[[2-[[5-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-1H-pyrazole-3-carbonyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid.
| Compound Name | 2-[[(2R)-2-[[2-[[5-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-1H-pyrazole-3-carbonyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 71716414 |
| Molecular Formula | C25H30N10O6S |
| Molecular Weight | 598.65 g/mol |
| Exact Mass | 598.21 |
| IUPAC Name | 2-[[(2R)-2-[[2-[[5-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-1H-pyrazole-3-carbonyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid |
| SMILES | Cc1nc(NC(=O)c2ccccc2)sc1-c1cc(C(=O)NCC(=O)N[C@H](CCCN=C(N)N)C(=O)NCC(=O)O)n[nH]1 |
| InChI | InChI=1S/C25H30N10O6S/c1-13-20(42-25(31-13)33-21(39)14-6-3-2-4-7-14)16-10-17(35-34-16)23(41)29-11-18(36)32-15(8-5-9-28-24(26)27)22(40)30-12-19(37)38/h2-4,6-7,10,15H,5,8-9,11-12H2,1H3,(H,29,41)(H,30,40)(H,32,36)(H,34,35)(H,37,38)(H4,26,27,28)(H,31,33,39)/t15-/m1/s1 |
| InChIKey | ZBAPDGMUDKGDDE-OAHLLOKOSA-N |
| XLogP | -0.44 |
| TPSA | 259.67 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.65 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|