C25H30N6O3 — CID 71716562
N-(1H-imidazol-5-ylmethyl)-2-(2-methoxyethylamino)-5,5-dimethyl-4-oxo-3-prop-2-enyl-6H-benzo[h]quinazoline-8-carboxamide (PubChem CID 71716562) has the molecular formula C25H30N6O3 and a molecular weight of 462.55 g/mol. Its IUPAC name is N-(1H-imidazol-5-ylmethyl)-2-(2-methoxyethylamino)-5,5-dimethyl-4-oxo-3-prop-2-enyl-6H-benzo[h]quinazoline-8-carboxamide.
| Compound Name | N-(1H-imidazol-5-ylmethyl)-2-(2-methoxyethylamino)-5,5-dimethyl-4-oxo-3-prop-2-enyl-6H-benzo[h]quinazoline-8-carboxamide |
|---|---|
| PubChem CID | 71716562 |
| Molecular Formula | C25H30N6O3 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | N-(1H-imidazol-5-ylmethyl)-2-(2-methoxyethylamino)-5,5-dimethyl-4-oxo-3-prop-2-enyl-6H-benzo[h]quinazoline-8-carboxamide |
| SMILES | C=CCn1c(NCCOC)nc2c(c1=O)C(C)(C)Cc1cc(C(=O)NCc3cnc[nH]3)ccc1-2 |
| InChI | InChI=1S/C25H30N6O3/c1-5-9-31-23(33)20-21(30-24(31)27-8-10-34-4)19-7-6-16(11-17(19)12-25(20,2)3)22(32)28-14-18-13-26-15-29-18/h5-7,11,13,15H,1,8-10,12,14H2,2-4H3,(H,26,29)(H,27,30)(H,28,32) |
| InChIKey | IVAKAESNVNJCLY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|