C21H32O11 — CID 71716635
(2S,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(1-phenylpropoxy)oxan-2-yl]methoxy]oxane-3,4,5-triol (PubChem CID 71716635) has the molecular formula C21H32O11 and a molecular weight of 460.48 g/mol. Its IUPAC name is (2S,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(1-phenylpropoxy)oxan-2-yl]methoxy]oxane-3,4,5-triol.
| Compound Name | (2S,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(1-phenylpropoxy)oxan-2-yl]methoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71716635 |
| Molecular Formula | C21H32O11 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | (2S,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(1-phenylpropoxy)oxan-2-yl]methoxy]oxane-3,4,5-triol |
| SMILES | CCC(O[C@@H]1O[C@@H](CO[C@@H]2O[C@@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O)c1ccccc1 |
| InChI | InChI=1S/C21H32O11/c1-2-11(10-6-4-3-5-7-10)30-21-19(28)17(26)15(24)13(32-21)9-29-20-18(27)16(25)14(23)12(8-22)31-20/h3-7,11-28H,2,8-9H2,1H3/t11?,12-,13-,14+,15+,16-,17-,18-,19-,20+,21+/m0/s1 |
| InChIKey | XGGHJWNOPDDRHZ-ISJITDOKSA-N |
| XLogP | -2.22 |
| TPSA | 178.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |