C9H15N5OS2 — CID 71716867
1-[(Z)-4-methylpentan-2-ylideneamino]-3-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)urea (PubChem CID 71716867) has the molecular formula C9H15N5OS2 and a molecular weight of 273.39 g/mol. Its IUPAC name is 1-[(Z)-4-methylpentan-2-ylideneamino]-3-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)urea.
| Compound Name | 1-[(Z)-4-methylpentan-2-ylideneamino]-3-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)urea |
|---|---|
| PubChem CID | 71716867 |
| Molecular Formula | C9H15N5OS2 |
| Molecular Weight | 273.39 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 1-[(Z)-4-methylpentan-2-ylideneamino]-3-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)urea |
| SMILES | C/C(CC(C)C)=N/NC(=O)Nc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C9H15N5OS2/c1-5(2)4-6(3)11-12-7(15)10-8-13-14-9(16)17-8/h5H,4H2,1-3H3,(H,14,16)(H2,10,12,13,15)/b11-6- |
| InChIKey | SGTLBLSHYXLNHB-WDZFZDKYSA-N |
| XLogP | 2.74 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|