About 2-ethoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenylethenyl]-2,4-dihydropyrrol-1-ium
2-ethoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenylethenyl]-2,4-dihydropyrrol-1-ium (PubChem CID 71716952) has the molecular formula C16H21NO2
and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-ethoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenylethenyl]-2,4-dihydropyrrol-1-ium.
Molecular Properties
| Compound Name | 2-ethoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenylethenyl]-2,4-dihydropyrrol-1-ium |
| PubChem CID | 71716952 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 2-ethoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenylethenyl]-2,4-dihydropyrrol-1-ium |
| SMILES | CCOC1[N+]([O-])=C(/C=C/c2ccccc2)CC1(C)C |
| InChI | InChI=1S/C16H21NO2/c1-4-19-15-16(2,3)12-14(17(15)18)11-10-13-8-6-5-7-9-13/h5-11,15H,4,12H2,1-3H3/b11-10+ |
| InChIKey | UHTFYSDUTPSIRH-ZHACJKMWSA-N |
| XLogP | 3.44 |
| TPSA | 35.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenylethenyl]-2,4-dihydropyrrol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenylethenyl]-2,4-dihydropyrrol-1-ium?
The IUPAC name of 2-ethoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenylethenyl]-2,4-dihydropyrrol-1-ium (CID 71716952) is 2-ethoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenylethenyl]-2,4-dihydropyrrol-1-ium.
What is the SMILES notation for 2-ethoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenylethenyl]-2,4-dihydropyrrol-1-ium?
The canonical SMILES for 2-ethoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenylethenyl]-2,4-dihydropyrrol-1-ium is CCOC1[N+]([O-])=C(/C=C/c2ccccc2)CC1(C)C.
What is the InChIKey of 2-ethoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenylethenyl]-2,4-dihydropyrrol-1-ium?
The InChIKey is UHTFYSDUTPSIRH-ZHACJKMWSA-N. The full InChI is InChI=1S/C16H21NO2/c1-4-19-15-16(2,3)12-14(17(15)18)11-10-13-8-6-5-7-9-13/h5-11,15H,4,12H2,1-3H3/b11-10+.
What are the key properties of 2-ethoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenylethenyl]-2,4-dihydropyrrol-1-ium?
2-ethoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenylethenyl]-2,4-dihydropyrrol-1-ium has a molecular weight of 259.35 g/mol, XLogP of 3.44, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenylethenyl]-2,4-dihydropyrrol-1-ium is sourced from PubChem (CID 71716952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).