About 2-methoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenanthren-9-ylethenyl]-2,4-dihydropyrrol-1-ium
2-methoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenanthren-9-ylethenyl]-2,4-dihydropyrrol-1-ium (PubChem CID 71716953) has the molecular formula C23H23NO2
and a molecular weight of 345.44 g/mol. Its IUPAC name is 2-methoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenanthren-9-ylethenyl]-2,4-dihydropyrrol-1-ium.
Molecular Properties
| Compound Name | 2-methoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenanthren-9-ylethenyl]-2,4-dihydropyrrol-1-ium |
| PubChem CID | 71716953 |
| Molecular Formula | C23H23NO2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 2-methoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenanthren-9-ylethenyl]-2,4-dihydropyrrol-1-ium |
| SMILES | COC1[N+]([O-])=C(/C=C/c2cc3ccccc3c3ccccc23)CC1(C)C |
| InChI | InChI=1S/C23H23NO2/c1-23(2)15-18(24(25)22(23)26-3)13-12-17-14-16-8-4-5-9-19(16)21-11-7-6-10-20(17)21/h4-14,22H,15H2,1-3H3/b13-12+ |
| InChIKey | BYPOMHXMDBPSNA-OUKQBFOZSA-N |
| XLogP | 5.36 |
| TPSA | 35.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenanthren-9-ylethenyl]-2,4-dihydropyrrol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenanthren-9-ylethenyl]-2,4-dihydropyrrol-1-ium?
The IUPAC name of 2-methoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenanthren-9-ylethenyl]-2,4-dihydropyrrol-1-ium (CID 71716953) is 2-methoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenanthren-9-ylethenyl]-2,4-dihydropyrrol-1-ium.
What is the SMILES notation for 2-methoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenanthren-9-ylethenyl]-2,4-dihydropyrrol-1-ium?
The canonical SMILES for 2-methoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenanthren-9-ylethenyl]-2,4-dihydropyrrol-1-ium is COC1[N+]([O-])=C(/C=C/c2cc3ccccc3c3ccccc23)CC1(C)C.
What is the InChIKey of 2-methoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenanthren-9-ylethenyl]-2,4-dihydropyrrol-1-ium?
The InChIKey is BYPOMHXMDBPSNA-OUKQBFOZSA-N. The full InChI is InChI=1S/C23H23NO2/c1-23(2)15-18(24(25)22(23)26-3)13-12-17-14-16-8-4-5-9-19(16)21-11-7-6-10-20(17)21/h4-14,22H,15H2,1-3H3/b13-12+.
What are the key properties of 2-methoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenanthren-9-ylethenyl]-2,4-dihydropyrrol-1-ium?
2-methoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenanthren-9-ylethenyl]-2,4-dihydropyrrol-1-ium has a molecular weight of 345.44 g/mol, XLogP of 5.36, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenanthren-9-ylethenyl]-2,4-dihydropyrrol-1-ium is sourced from PubChem (CID 71716953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).