C14H16N2O4 — CID 71716967
N-hydroxy-1-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]pyrrolidine-2-carboxamide (PubChem CID 71716967) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is N-hydroxy-1-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]pyrrolidine-2-carboxamide.
| Compound Name | N-hydroxy-1-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 71716967 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | N-hydroxy-1-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NO)C1CCCN1C(=O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C14H16N2O4/c17-11-6-3-10(4-7-11)5-8-13(18)16-9-1-2-12(16)14(19)15-20/h3-8,12,17,20H,1-2,9H2,(H,15,19)/b8-5+ |
| InChIKey | SPGLLGNVUXMNMT-VMPITWQZSA-N |
| XLogP | 0.90 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|