About 2,2-dioxo-1,2λ6-benzoxathiin-6-ol
2,2-dioxo-1,2λ6-benzoxathiin-6-ol (PubChem CID 71717570) has the molecular formula C8H6O4S
and a molecular weight of 198.20 g/mol. Its IUPAC name is 2,2-dioxo-1,2λ6-benzoxathiin-6-ol.
Molecular Properties
| Compound Name | 2,2-dioxo-1,2λ6-benzoxathiin-6-ol |
| PubChem CID | 71717570 |
| Molecular Formula | C8H6O4S |
| Molecular Weight | 198.20 g/mol |
| Exact Mass | 198.00 |
| IUPAC Name | 2,2-dioxo-1,2λ6-benzoxathiin-6-ol |
| SMILES | O=S1(=O)C=Cc2cc(O)ccc2O1 |
| InChI | InChI=1S/C8H6O4S/c9-7-1-2-8-6(5-7)3-4-13(10,11)12-8/h1-5,9H |
| InChIKey | VAQVBXKIUYUXIY-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dioxo-1,2λ6-benzoxathiin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dioxo-1,2λ6-benzoxathiin-6-ol?
The IUPAC name of 2,2-dioxo-1,2λ6-benzoxathiin-6-ol (CID 71717570) is 2,2-dioxo-1,2λ6-benzoxathiin-6-ol.
What is the SMILES notation for 2,2-dioxo-1,2λ6-benzoxathiin-6-ol?
The canonical SMILES for 2,2-dioxo-1,2λ6-benzoxathiin-6-ol is O=S1(=O)C=Cc2cc(O)ccc2O1.
What is the InChIKey of 2,2-dioxo-1,2λ6-benzoxathiin-6-ol?
The InChIKey is VAQVBXKIUYUXIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4S/c9-7-1-2-8-6(5-7)3-4-13(10,11)12-8/h1-5,9H.
What are the key properties of 2,2-dioxo-1,2λ6-benzoxathiin-6-ol?
2,2-dioxo-1,2λ6-benzoxathiin-6-ol has a molecular weight of 198.20 g/mol, XLogP of 1.09, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dioxo-1,2λ6-benzoxathiin-6-ol is sourced from PubChem (CID 71717570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).