C27H39NO20S — CID 71717694
[(2S,3R,4S,5R,6S)-4,5,6-triacetyloxy-3-[[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(sulfamoyloxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]methyl acetate (PubChem CID 71717694) has the molecular formula C27H39NO20S and a molecular weight of 729.66 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6S)-4,5,6-triacetyloxy-3-[[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(sulfamoyloxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4S,5R,6S)-4,5,6-triacetyloxy-3-[[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(sulfamoyloxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71717694 |
| Molecular Formula | C27H39NO20S |
| Molecular Weight | 729.66 g/mol |
| Exact Mass | 729.18 |
| IUPAC Name | [(2S,3R,4S,5R,6S)-4,5,6-triacetyloxy-3-[[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(sulfamoyloxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1CO[C@H]1O[C@H](COS(N)(=O)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C27H39NO20S/c1-11(29)38-9-19-18(21(41-12(2)30)24(44-15(5)33)27(47-19)46-17(7)35)8-39-26-25(45-16(6)34)23(43-14(4)32)22(42-13(3)31)20(48-26)10-40-49(28,36)37/h18-27H,8-10H2,1-7H3,(H2,28,36,37)/t18-,19-,20-,21+,22-,23+,24-,25-,26+,27-/m1/s1 |
| InChIKey | ATVAAONNJGWSTM-WUNGCRCYSA-N |
| XLogP | -1.93 |
| TPSA | 281.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.66 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|