C24H19F5N4O — CID 71717974
N-(3,5-difluorophenyl)-2-(4-morpholin-4-ylphenyl)-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-4-amine (PubChem CID 71717974) has the molecular formula C24H19F5N4O and a molecular weight of 474.43 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-2-(4-morpholin-4-ylphenyl)-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-4-amine.
| Compound Name | N-(3,5-difluorophenyl)-2-(4-morpholin-4-ylphenyl)-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-4-amine |
|---|---|
| PubChem CID | 71717974 |
| Molecular Formula | C24H19F5N4O |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | N-(3,5-difluorophenyl)-2-(4-morpholin-4-ylphenyl)-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-4-amine |
| SMILES | Fc1cc(F)cc(Nc2c(C(F)(F)F)cnc3[nH]c(-c4ccc(N5CCOCC5)cc4)cc23)c1 |
| InChI | InChI=1S/C24H19F5N4O/c25-15-9-16(26)11-17(10-15)31-22-19-12-21(32-23(19)30-13-20(22)24(27,28)29)14-1-3-18(4-2-14)33-5-7-34-8-6-33/h1-4,9-13H,5-8H2,(H2,30,31,32) |
| InChIKey | UUUWGYOSJVGVMJ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|