C26H24N2O4 — CID 71718001
(1-benzyl-4-phenylimidazol-2-yl)-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 71718001) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is (1-benzyl-4-phenylimidazol-2-yl)-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | (1-benzyl-4-phenylimidazol-2-yl)-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 71718001 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | (1-benzyl-4-phenylimidazol-2-yl)-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)c2nc(-c3ccccc3)cn2Cc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C26H24N2O4/c1-30-22-14-20(15-23(31-2)25(22)32-3)24(29)26-27-21(19-12-8-5-9-13-19)17-28(26)16-18-10-6-4-7-11-18/h4-15,17H,16H2,1-3H3 |
| InChIKey | UCLFOJXOEHSHIB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |