C34H46INO4 — CID 71718036
dibenzyl-[10-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)decyl]-methylazanium iodide (PubChem CID 71718036) has the molecular formula C34H46INO4 and a molecular weight of 659.65 g/mol. Its IUPAC name is dibenzyl-[10-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)decyl]-methylazanium iodide.
| Compound Name | dibenzyl-[10-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)decyl]-methylazanium iodide |
|---|---|
| PubChem CID | 71718036 |
| Molecular Formula | C34H46INO4 |
| Molecular Weight | 659.65 g/mol |
| Exact Mass | 659.25 |
| IUPAC Name | dibenzyl-[10-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)decyl]-methylazanium iodide |
| SMILES | COC1=C(OC)C(=O)C(CCCCCCCCCC[N+](C)(Cc2ccccc2)Cc2ccccc2)=C(C)C1=O.[I-] |
| InChI | InChI=1S/C34H46NO4.HI/c1-27-30(32(37)34(39-4)33(38-3)31(27)36)23-17-9-7-5-6-8-10-18-24-35(2,25-28-19-13-11-14-20-28)26-29-21-15-12-16-22-29;/h11-16,19-22H,5-10,17-18,23-26H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | XYPIEHWAFSYKHH-UHFFFAOYSA-M |
| XLogP | 4.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.65 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|