About 2-(2-phenylphenoxy)-5-(1,3-thiazol-2-ylsulfamoyl)benzamide
2-(2-phenylphenoxy)-5-(1,3-thiazol-2-ylsulfamoyl)benzamide (PubChem CID 71718164) has the molecular formula C22H17N3O4S2
and a molecular weight of 451.53 g/mol. Its IUPAC name is 2-(2-phenylphenoxy)-5-(1,3-thiazol-2-ylsulfamoyl)benzamide.
Molecular Properties
| Compound Name | 2-(2-phenylphenoxy)-5-(1,3-thiazol-2-ylsulfamoyl)benzamide |
| PubChem CID | 71718164 |
| Molecular Formula | C22H17N3O4S2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | 2-(2-phenylphenoxy)-5-(1,3-thiazol-2-ylsulfamoyl)benzamide |
| SMILES | NC(=O)c1cc(S(=O)(=O)Nc2nccs2)ccc1Oc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C22H17N3O4S2/c23-21(26)18-14-16(31(27,28)25-22-24-12-13-30-22)10-11-20(18)29-19-9-5-4-8-17(19)15-6-2-1-3-7-15/h1-14H,(H2,23,26)(H,24,25) |
| InChIKey | PDPMEPWPVGASDH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(2-phenylphenoxy)-5-(1,3-thiazol-2-ylsulfamoyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-phenylphenoxy)-5-(1,3-thiazol-2-ylsulfamoyl)benzamide?
The IUPAC name of 2-(2-phenylphenoxy)-5-(1,3-thiazol-2-ylsulfamoyl)benzamide (CID 71718164) is 2-(2-phenylphenoxy)-5-(1,3-thiazol-2-ylsulfamoyl)benzamide.
What is the SMILES notation for 2-(2-phenylphenoxy)-5-(1,3-thiazol-2-ylsulfamoyl)benzamide?
The canonical SMILES for 2-(2-phenylphenoxy)-5-(1,3-thiazol-2-ylsulfamoyl)benzamide is NC(=O)c1cc(S(=O)(=O)Nc2nccs2)ccc1Oc1ccccc1-c1ccccc1.
What is the InChIKey of 2-(2-phenylphenoxy)-5-(1,3-thiazol-2-ylsulfamoyl)benzamide?
The InChIKey is PDPMEPWPVGASDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17N3O4S2/c23-21(26)18-14-16(31(27,28)25-22-24-12-13-30-22)10-11-20(18)29-19-9-5-4-8-17(19)15-6-2-1-3-7-15/h1-14H,(H2,23,26)(H,24,25).
What are the key properties of 2-(2-phenylphenoxy)-5-(1,3-thiazol-2-ylsulfamoyl)benzamide?
2-(2-phenylphenoxy)-5-(1,3-thiazol-2-ylsulfamoyl)benzamide has a molecular weight of 451.53 g/mol, XLogP of 4.50, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-phenylphenoxy)-5-(1,3-thiazol-2-ylsulfamoyl)benzamide is sourced from PubChem (CID 71718164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).