C15H22O3 — CID 71718216
(1R,3S,4R,5S,8R,10R,14S)-5,10,14-trimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one (PubChem CID 71718216) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (1R,3S,4R,5S,8R,10R,14S)-5,10,14-trimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one.
| Compound Name | (1R,3S,4R,5S,8R,10R,14S)-5,10,14-trimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one |
|---|---|
| PubChem CID | 71718216 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (1R,3S,4R,5S,8R,10R,14S)-5,10,14-trimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one |
| SMILES | C[C@@H]1C(=O)O[C@@H]2C[C@@]3(C)CCC[C@H](C)[C@@]34O[C@H]4[C@H]12 |
| InChI | InChI=1S/C15H22O3/c1-8-5-4-6-14(3)7-10-11(9(2)13(16)17-10)12-15(8,14)18-12/h8-12H,4-7H2,1-3H3/t8-,9-,10+,11+,12-,14+,15-/m0/s1 |
| InChIKey | BAQGIZKIYSRPFK-HWLKTZOTSA-N |
| XLogP | 2.53 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|