C20H32N2O6 — CID 71718230
benzyl N-[6-[(2R,3S,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]carbamate (PubChem CID 71718230) has the molecular formula C20H32N2O6 and a molecular weight of 396.48 g/mol. Its IUPAC name is benzyl N-[6-[(2R,3S,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]carbamate.
| Compound Name | benzyl N-[6-[(2R,3S,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]carbamate |
|---|---|
| PubChem CID | 71718230 |
| Molecular Formula | C20H32N2O6 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | benzyl N-[6-[(2R,3S,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]carbamate |
| SMILES | O=C(NCCCCCCN1C[C@H](O)[C@@H](O)[C@@H](O)[C@H]1CO)OCc1ccccc1 |
| InChI | InChI=1S/C20H32N2O6/c23-13-16-18(25)19(26)17(24)12-22(16)11-7-2-1-6-10-21-20(27)28-14-15-8-4-3-5-9-15/h3-5,8-9,16-19,23-26H,1-2,6-7,10-14H2,(H,21,27)/t16-,17+,18+,19-/m1/s1 |
| InChIKey | JFFCOMHANLMQEI-YDZRNGNQSA-N |
| XLogP | 0.23 |
| TPSA | 122.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|