C22H24ClNO4 — CID 71718239
2,4,6-trimethyl-1-[2-(2-phenylphenyl)ethyl]pyridin-1-ium perchlorate (PubChem CID 71718239) has the molecular formula C22H24ClNO4 and a molecular weight of 401.89 g/mol. Its IUPAC name is 2,4,6-trimethyl-1-[2-(2-phenylphenyl)ethyl]pyridin-1-ium perchlorate.
| Compound Name | 2,4,6-trimethyl-1-[2-(2-phenylphenyl)ethyl]pyridin-1-ium perchlorate |
|---|---|
| PubChem CID | 71718239 |
| Molecular Formula | C22H24ClNO4 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 2,4,6-trimethyl-1-[2-(2-phenylphenyl)ethyl]pyridin-1-ium perchlorate |
| SMILES | Cc1cc(C)[n+](CCc2ccccc2-c2ccccc2)c(C)c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C22H24N.ClHO4/c1-17-15-18(2)23(19(3)16-17)14-13-21-11-7-8-12-22(21)20-9-5-4-6-10-20;2-1(3,4)5/h4-12,15-16H,13-14H2,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | ATOCPIDNIWTAKJ-UHFFFAOYSA-M |
| XLogP | 0.05 |
| TPSA | 96.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|