C30H45N7O3 — CID 71718267
(2S)-6-amino-N-[4-(diaminomethylideneamino)butyl]-2-[[(2S)-3-methyl-2-[[2-oxo-2-(4-phenylphenyl)ethyl]amino]butanoyl]amino]hexanamide (PubChem CID 71718267) has the molecular formula C30H45N7O3 and a molecular weight of 551.74 g/mol. Its IUPAC name is (2S)-6-amino-N-[4-(diaminomethylideneamino)butyl]-2-[[(2S)-3-methyl-2-[[2-oxo-2-(4-phenylphenyl)ethyl]amino]butanoyl]amino]hexanamide.
| Compound Name | (2S)-6-amino-N-[4-(diaminomethylideneamino)butyl]-2-[[(2S)-3-methyl-2-[[2-oxo-2-(4-phenylphenyl)ethyl]amino]butanoyl]amino]hexanamide |
|---|---|
| PubChem CID | 71718267 |
| Molecular Formula | C30H45N7O3 |
| Molecular Weight | 551.74 g/mol |
| Exact Mass | 551.36 |
| IUPAC Name | (2S)-6-amino-N-[4-(diaminomethylideneamino)butyl]-2-[[(2S)-3-methyl-2-[[2-oxo-2-(4-phenylphenyl)ethyl]amino]butanoyl]amino]hexanamide |
| SMILES | CC(C)[C@H](NCC(=O)c1ccc(-c2ccccc2)cc1)C(=O)N[C@@H](CCCCN)C(=O)NCCCCN=C(N)N |
| InChI | InChI=1S/C30H45N7O3/c1-21(2)27(36-20-26(38)24-15-13-23(14-16-24)22-10-4-3-5-11-22)29(40)37-25(12-6-7-17-31)28(39)34-18-8-9-19-35-30(32)33/h3-5,10-11,13-16,21,25,27,36H,6-9,12,17-20,31H2,1-2H3,(H,34,39)(H,37,40)(H4,32,33,35)/t25-,27-/m0/s1 |
| InChIKey | HXINISOMLWGIRS-BDYUSTAISA-N |
| XLogP | 1.93 |
| TPSA | 177.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.74 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|