About N-[(1S,3S)-3-[(3-chlorobenzoyl)amino]cyclohexyl]pyridine-4-carboxamide
N-[(1S,3S)-3-[(3-chlorobenzoyl)amino]cyclohexyl]pyridine-4-carboxamide (PubChem CID 71718341) has the molecular formula C19H20ClN3O2
and a molecular weight of 357.84 g/mol. Its IUPAC name is N-[(1S,3S)-3-[(3-chlorobenzoyl)amino]cyclohexyl]pyridine-4-carboxamide.
Molecular Properties
| Compound Name | N-[(1S,3S)-3-[(3-chlorobenzoyl)amino]cyclohexyl]pyridine-4-carboxamide |
| PubChem CID | 71718341 |
| Molecular Formula | C19H20ClN3O2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | N-[(1S,3S)-3-[(3-chlorobenzoyl)amino]cyclohexyl]pyridine-4-carboxamide |
| SMILES | O=C(N[C@H]1CCC[C@H](NC(=O)c2cccc(Cl)c2)C1)c1ccncc1 |
| InChI | InChI=1S/C19H20ClN3O2/c20-15-4-1-3-14(11-15)19(25)23-17-6-2-5-16(12-17)22-18(24)13-7-9-21-10-8-13/h1,3-4,7-11,16-17H,2,5-6,12H2,(H,22,24)(H,23,25)/t16-,17-/m0/s1 |
| InChIKey | UOUAHARLYWMUJP-IRXDYDNUSA-N |
| XLogP | 3.21 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1S,3S)-3-[(3-chlorobenzoyl)amino]cyclohexyl]pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S,3S)-3-[(3-chlorobenzoyl)amino]cyclohexyl]pyridine-4-carboxamide?
The IUPAC name of N-[(1S,3S)-3-[(3-chlorobenzoyl)amino]cyclohexyl]pyridine-4-carboxamide (CID 71718341) is N-[(1S,3S)-3-[(3-chlorobenzoyl)amino]cyclohexyl]pyridine-4-carboxamide.
What is the SMILES notation for N-[(1S,3S)-3-[(3-chlorobenzoyl)amino]cyclohexyl]pyridine-4-carboxamide?
The canonical SMILES for N-[(1S,3S)-3-[(3-chlorobenzoyl)amino]cyclohexyl]pyridine-4-carboxamide is O=C(N[C@H]1CCC[C@H](NC(=O)c2cccc(Cl)c2)C1)c1ccncc1.
What is the InChIKey of N-[(1S,3S)-3-[(3-chlorobenzoyl)amino]cyclohexyl]pyridine-4-carboxamide?
The InChIKey is UOUAHARLYWMUJP-IRXDYDNUSA-N. The full InChI is InChI=1S/C19H20ClN3O2/c20-15-4-1-3-14(11-15)19(25)23-17-6-2-5-16(12-17)22-18(24)13-7-9-21-10-8-13/h1,3-4,7-11,16-17H,2,5-6,12H2,(H,22,24)(H,23,25)/t16-,17-/m0/s1.
What are the key properties of N-[(1S,3S)-3-[(3-chlorobenzoyl)amino]cyclohexyl]pyridine-4-carboxamide?
N-[(1S,3S)-3-[(3-chlorobenzoyl)amino]cyclohexyl]pyridine-4-carboxamide has a molecular weight of 357.84 g/mol, XLogP of 3.21, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S,3S)-3-[(3-chlorobenzoyl)amino]cyclohexyl]pyridine-4-carboxamide is sourced from PubChem (CID 71718341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).