C21H25N3O4 — CID 71718399
2-[[2-(ethylamino)-5,5-dimethyl-4-oxo-3-prop-2-enyl-6H-benzo[h]quinazolin-8-yl]oxy]acetic acid (PubChem CID 71718399) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is 2-[[2-(ethylamino)-5,5-dimethyl-4-oxo-3-prop-2-enyl-6H-benzo[h]quinazolin-8-yl]oxy]acetic acid.
| Compound Name | 2-[[2-(ethylamino)-5,5-dimethyl-4-oxo-3-prop-2-enyl-6H-benzo[h]quinazolin-8-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 71718399 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 2-[[2-(ethylamino)-5,5-dimethyl-4-oxo-3-prop-2-enyl-6H-benzo[h]quinazolin-8-yl]oxy]acetic acid |
| SMILES | C=CCn1c(NCC)nc2c(c1=O)C(C)(C)Cc1cc(OCC(=O)O)ccc1-2 |
| InChI | InChI=1S/C21H25N3O4/c1-5-9-24-19(27)17-18(23-20(24)22-6-2)15-8-7-14(28-12-16(25)26)10-13(15)11-21(17,3)4/h5,7-8,10H,1,6,9,11-12H2,2-4H3,(H,22,23)(H,25,26) |
| InChIKey | XOOAVUIEVGAVPV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|