C33H29BrN4O6 — CID 71718508
benzyl N-[(1S,9R,16S,19S)-6-bromo-22-formyl-17-oxo-19-propan-2-yl-10,26-dioxa-8,18,21-triazahexacyclo[12.9.2.120,23.01,9.02,7.011,24]hexacosa-2(7),3,5,11(24),12,14(25),20,22-octaen-16-yl]carbamate (PubChem CID 71718508) has the molecular formula C33H29BrN4O6 and a molecular weight of 657.52 g/mol. Its IUPAC name is benzyl N-[(1S,9R,16S,19S)-6-bromo-22-formyl-17-oxo-19-propan-2-yl-10,26-dioxa-8,18,21-triazahexacyclo[12.9.2.120,23.01,9.02,7.011,24]hexacosa-2(7),3,5,11(24),12,14(25),20,22-octaen-16-yl]carbamate.
| Compound Name | benzyl N-[(1S,9R,16S,19S)-6-bromo-22-formyl-17-oxo-19-propan-2-yl-10,26-dioxa-8,18,21-triazahexacyclo[12.9.2.120,23.01,9.02,7.011,24]hexacosa-2(7),3,5,11(24),12,14(25),20,22-octaen-16-yl]carbamate |
|---|---|
| PubChem CID | 71718508 |
| Molecular Formula | C33H29BrN4O6 |
| Molecular Weight | 657.52 g/mol |
| Exact Mass | 656.13 |
| IUPAC Name | benzyl N-[(1S,9R,16S,19S)-6-bromo-22-formyl-17-oxo-19-propan-2-yl-10,26-dioxa-8,18,21-triazahexacyclo[12.9.2.120,23.01,9.02,7.011,24]hexacosa-2(7),3,5,11(24),12,14(25),20,22-octaen-16-yl]carbamate |
| SMILES | CC(C)[C@@H]1NC(=O)[C@@H](NC(=O)OCc2ccccc2)Cc2ccc3c(c2)[C@@]2(c4cccc(Br)c4N[C@@H]2O3)c2oc1nc2C=O |
| InChI | InChI=1S/C33H29BrN4O6/c1-17(2)26-30-35-24(15-39)28(44-30)33-20-9-6-10-22(34)27(20)38-31(33)43-25-12-11-19(13-21(25)33)14-23(29(40)37-26)36-32(41)42-16-18-7-4-3-5-8-18/h3-13,15,17,23,26,31,38H,14,16H2,1-2H3,(H,36,41)(H,37,40)/t23-,26-,31+,33-/m0/s1 |
| InChIKey | AJVHPLZQRGVGJI-TYVOWPKXSA-N |
| XLogP | 5.39 |
| TPSA | 131.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|