About (2R)-4-(4-bromo-1-methylimidazol-2-yl)oxy-N,N-dimethylbutan-2-amine
(2R)-4-(4-bromo-1-methylimidazol-2-yl)oxy-N,N-dimethylbutan-2-amine (PubChem CID 71718543) has the molecular formula C10H18BrN3O
and a molecular weight of 276.18 g/mol. Its IUPAC name is (2R)-4-(4-bromo-1-methylimidazol-2-yl)oxy-N,N-dimethylbutan-2-amine.
Molecular Properties
| Compound Name | (2R)-4-(4-bromo-1-methylimidazol-2-yl)oxy-N,N-dimethylbutan-2-amine |
| PubChem CID | 71718543 |
| Molecular Formula | C10H18BrN3O |
| Molecular Weight | 276.18 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | (2R)-4-(4-bromo-1-methylimidazol-2-yl)oxy-N,N-dimethylbutan-2-amine |
| SMILES | C[C@H](CCOc1nc(Br)cn1C)N(C)C |
| InChI | InChI=1S/C10H18BrN3O/c1-8(13(2)3)5-6-15-10-12-9(11)7-14(10)4/h7-8H,5-6H2,1-4H3/t8-/m1/s1 |
| InChIKey | BLXVYQSFONFXJI-MRVPVSSYSA-N |
| XLogP | 1.90 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.18 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-4-(4-bromo-1-methylimidazol-2-yl)oxy-N,N-dimethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4-(4-bromo-1-methylimidazol-2-yl)oxy-N,N-dimethylbutan-2-amine?
The IUPAC name of (2R)-4-(4-bromo-1-methylimidazol-2-yl)oxy-N,N-dimethylbutan-2-amine (CID 71718543) is (2R)-4-(4-bromo-1-methylimidazol-2-yl)oxy-N,N-dimethylbutan-2-amine.
What is the SMILES notation for (2R)-4-(4-bromo-1-methylimidazol-2-yl)oxy-N,N-dimethylbutan-2-amine?
The canonical SMILES for (2R)-4-(4-bromo-1-methylimidazol-2-yl)oxy-N,N-dimethylbutan-2-amine is C[C@H](CCOc1nc(Br)cn1C)N(C)C.
What is the InChIKey of (2R)-4-(4-bromo-1-methylimidazol-2-yl)oxy-N,N-dimethylbutan-2-amine?
The InChIKey is BLXVYQSFONFXJI-MRVPVSSYSA-N. The full InChI is InChI=1S/C10H18BrN3O/c1-8(13(2)3)5-6-15-10-12-9(11)7-14(10)4/h7-8H,5-6H2,1-4H3/t8-/m1/s1.
What are the key properties of (2R)-4-(4-bromo-1-methylimidazol-2-yl)oxy-N,N-dimethylbutan-2-amine?
(2R)-4-(4-bromo-1-methylimidazol-2-yl)oxy-N,N-dimethylbutan-2-amine has a molecular weight of 276.18 g/mol, XLogP of 1.90, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4-(4-bromo-1-methylimidazol-2-yl)oxy-N,N-dimethylbutan-2-amine is sourced from PubChem (CID 71718543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).