C22H26N2O3 — CID 71718679
4-phenyl-5-propyl-2-[(3,4,5-trimethoxyphenyl)methyl]-1H-imidazole (PubChem CID 71718679) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 4-phenyl-5-propyl-2-[(3,4,5-trimethoxyphenyl)methyl]-1H-imidazole.
| Compound Name | 4-phenyl-5-propyl-2-[(3,4,5-trimethoxyphenyl)methyl]-1H-imidazole |
|---|---|
| PubChem CID | 71718679 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 4-phenyl-5-propyl-2-[(3,4,5-trimethoxyphenyl)methyl]-1H-imidazole |
| SMILES | CCCc1[nH]c(Cc2cc(OC)c(OC)c(OC)c2)nc1-c1ccccc1 |
| InChI | InChI=1S/C22H26N2O3/c1-5-9-17-21(16-10-7-6-8-11-16)24-20(23-17)14-15-12-18(25-2)22(27-4)19(13-15)26-3/h6-8,10-13H,5,9,14H2,1-4H3,(H,23,24) |
| InChIKey | SAERFGGEBCVEBT-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 56.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |