C23H27N9O5S — CID 71718857
(2R)-2-[[2-[[5-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-1H-pyrazole-3-carbonyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 71718857) has the molecular formula C23H27N9O5S and a molecular weight of 541.59 g/mol. Its IUPAC name is (2R)-2-[[2-[[5-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-1H-pyrazole-3-carbonyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2R)-2-[[2-[[5-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-1H-pyrazole-3-carbonyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 71718857 |
| Molecular Formula | C23H27N9O5S |
| Molecular Weight | 541.59 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | (2R)-2-[[2-[[5-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-1H-pyrazole-3-carbonyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | Cc1nc(NC(=O)c2ccccc2)sc1-c1cc(C(=O)NCC(=O)N[C@H](CCCN=C(N)N)C(=O)O)n[nH]1 |
| InChI | InChI=1S/C23H27N9O5S/c1-12-18(38-23(28-12)30-19(34)13-6-3-2-4-7-13)15-10-16(32-31-15)20(35)27-11-17(33)29-14(21(36)37)8-5-9-26-22(24)25/h2-4,6-7,10,14H,5,8-9,11H2,1H3,(H,27,35)(H,29,33)(H,31,32)(H,36,37)(H4,24,25,26)(H,28,30,34)/t14-/m1/s1 |
| InChIKey | ALUJLOKYQCMEFZ-CQSZACIVSA-N |
| XLogP | 0.45 |
| TPSA | 230.57 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.59 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|