C30H30O6 — CID 71718866
(1S,2S,13R,18R)-8-hydroxy-15-(3-methylbut-2-enyl)-18-(2-phenylethoxymethyl)-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraene-10,14-dione (PubChem CID 71718866) has the molecular formula C30H30O6 and a molecular weight of 486.56 g/mol. Its IUPAC name is (1S,2S,13R,18R)-8-hydroxy-15-(3-methylbut-2-enyl)-18-(2-phenylethoxymethyl)-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraene-10,14-dione.
| Compound Name | (1S,2S,13R,18R)-8-hydroxy-15-(3-methylbut-2-enyl)-18-(2-phenylethoxymethyl)-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraene-10,14-dione |
|---|---|
| PubChem CID | 71718866 |
| Molecular Formula | C30H30O6 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | (1S,2S,13R,18R)-8-hydroxy-15-(3-methylbut-2-enyl)-18-(2-phenylethoxymethyl)-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraene-10,14-dione |
| SMILES | CC(C)=CCC12OC[C@@H]3[C@@H](COCCc4ccccc4)[C@@H](C=C4C(=O)c5c(O)cccc5O[C@]431)C2=O |
| InChI | InChI=1S/C30H30O6/c1-18(2)11-13-29-28(33)20-15-22-27(32)26-24(31)9-6-10-25(26)36-30(22,29)23(17-35-29)21(20)16-34-14-12-19-7-4-3-5-8-19/h3-11,15,20-21,23,31H,12-14,16-17H2,1-2H3/t20-,21+,23-,29?,30-/m1/s1 |
| InChIKey | XTQBIQOZQZIJJW-HQCJEUBQSA-N |
| XLogP | 4.46 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|