C25H39NO7 — CID 71719031
(E)-but-2-enedioic acid;(1S,2S,4R,7Z,11S,12R)-4,8-dimethyl-12-[[methyl(pentyl)amino]methyl]-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one (PubChem CID 71719031) has the molecular formula C25H39NO7 and a molecular weight of 465.59 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(1S,2S,4R,7Z,11S,12R)-4,8-dimethyl-12-[[methyl(pentyl)amino]methyl]-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one.
| Compound Name | (E)-but-2-enedioic acid;(1S,2S,4R,7Z,11S,12R)-4,8-dimethyl-12-[[methyl(pentyl)amino]methyl]-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one |
|---|---|
| PubChem CID | 71719031 |
| Molecular Formula | C25H39NO7 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | (E)-but-2-enedioic acid;(1S,2S,4R,7Z,11S,12R)-4,8-dimethyl-12-[[methyl(pentyl)amino]methyl]-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one |
| SMILES | CCCCCN(C)C[C@@H]1C(=O)O[C@H]2[C@H]1CC/C(C)=C\CC[C@@]1(C)O[C@@H]21.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C21H35NO3.C4H4O4/c1-5-6-7-13-22(4)14-17-16-11-10-15(2)9-8-12-21(3)19(25-21)18(16)24-20(17)23;5-3(6)1-2-4(7)8/h9,16-19H,5-8,10-14H2,1-4H3;1-2H,(H,5,6)(H,7,8)/b15-9-;2-1+/t16-,17-,18-,19-,21+;/m0./s1 |
| InChIKey | WYKHHUJTXWLFKS-LRDGQRIHSA-N |
| XLogP | 3.66 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|