About benzo[f][1,2]benzoxathiine 3,3-dioxide
benzo[f][1,2]benzoxathiine 3,3-dioxide (PubChem CID 71719377) has the molecular formula C12H8O3S
and a molecular weight of 232.26 g/mol. Its IUPAC name is benzo[f][1,2]benzoxathiine 3,3-dioxide.
Molecular Properties
| Compound Name | benzo[f][1,2]benzoxathiine 3,3-dioxide |
| PubChem CID | 71719377 |
| Molecular Formula | C12H8O3S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | benzo[f][1,2]benzoxathiine 3,3-dioxide |
| SMILES | O=S1(=O)C=Cc2c(ccc3ccccc23)O1 |
| InChI | InChI=1S/C12H8O3S/c13-16(14)8-7-11-10-4-2-1-3-9(10)5-6-12(11)15-16/h1-8H |
| InChIKey | CTICYRBFRXPYCJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze benzo[f][1,2]benzoxathiine 3,3-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[f][1,2]benzoxathiine 3,3-dioxide?
The IUPAC name of benzo[f][1,2]benzoxathiine 3,3-dioxide (CID 71719377) is benzo[f][1,2]benzoxathiine 3,3-dioxide.
What is the SMILES notation for benzo[f][1,2]benzoxathiine 3,3-dioxide?
The canonical SMILES for benzo[f][1,2]benzoxathiine 3,3-dioxide is O=S1(=O)C=Cc2c(ccc3ccccc23)O1.
What is the InChIKey of benzo[f][1,2]benzoxathiine 3,3-dioxide?
The InChIKey is CTICYRBFRXPYCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O3S/c13-16(14)8-7-11-10-4-2-1-3-9(10)5-6-12(11)15-16/h1-8H.
What are the key properties of benzo[f][1,2]benzoxathiine 3,3-dioxide?
benzo[f][1,2]benzoxathiine 3,3-dioxide has a molecular weight of 232.26 g/mol, XLogP of 2.53, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[f][1,2]benzoxathiine 3,3-dioxide is sourced from PubChem (CID 71719377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).