C20H29Cl2N3O4S — CID 71719907
2,4-dichloro-N-[[4-(4-propylsulfonylpiperazin-1-yl)oxan-4-yl]methyl]benzamide (PubChem CID 71719907) has the molecular formula C20H29Cl2N3O4S and a molecular weight of 478.44 g/mol. Its IUPAC name is 2,4-dichloro-N-[[4-(4-propylsulfonylpiperazin-1-yl)oxan-4-yl]methyl]benzamide.
| Compound Name | 2,4-dichloro-N-[[4-(4-propylsulfonylpiperazin-1-yl)oxan-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 71719907 |
| Molecular Formula | C20H29Cl2N3O4S |
| Molecular Weight | 478.44 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 2,4-dichloro-N-[[4-(4-propylsulfonylpiperazin-1-yl)oxan-4-yl]methyl]benzamide |
| SMILES | CCCS(=O)(=O)N1CCN(C2(CNC(=O)c3ccc(Cl)cc3Cl)CCOCC2)CC1 |
| InChI | InChI=1S/C20H29Cl2N3O4S/c1-2-13-30(27,28)25-9-7-24(8-10-25)20(5-11-29-12-6-20)15-23-19(26)17-4-3-16(21)14-18(17)22/h3-4,14H,2,5-13,15H2,1H3,(H,23,26) |
| InChIKey | CJCMXVJHXTZOFD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |