About 4,5-dichloro-6-ethyl-2-pyridin-3-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine
4,5-dichloro-6-ethyl-2-pyridin-3-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 71719999) has the molecular formula C13H10Cl2N4S
and a molecular weight of 325.22 g/mol. Its IUPAC name is 4,5-dichloro-6-ethyl-2-pyridin-3-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 4,5-dichloro-6-ethyl-2-pyridin-3-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine |
| PubChem CID | 71719999 |
| Molecular Formula | C13H10Cl2N4S |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 4,5-dichloro-6-ethyl-2-pyridin-3-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | CCc1[nH]c2nc(Sc3cccnc3)nc(Cl)c2c1Cl |
| InChI | InChI=1S/C13H10Cl2N4S/c1-2-8-10(14)9-11(15)18-13(19-12(9)17-8)20-7-4-3-5-16-6-7/h3-6H,2H2,1H3,(H,17,18,19) |
| InChIKey | BAWKJONAJYCILR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-dichloro-6-ethyl-2-pyridin-3-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-6-ethyl-2-pyridin-3-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine?
The IUPAC name of 4,5-dichloro-6-ethyl-2-pyridin-3-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine (CID 71719999) is 4,5-dichloro-6-ethyl-2-pyridin-3-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 4,5-dichloro-6-ethyl-2-pyridin-3-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 4,5-dichloro-6-ethyl-2-pyridin-3-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine is CCc1[nH]c2nc(Sc3cccnc3)nc(Cl)c2c1Cl.
What is the InChIKey of 4,5-dichloro-6-ethyl-2-pyridin-3-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine?
The InChIKey is BAWKJONAJYCILR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl2N4S/c1-2-8-10(14)9-11(15)18-13(19-12(9)17-8)20-7-4-3-5-16-6-7/h3-6H,2H2,1H3,(H,17,18,19).
What are the key properties of 4,5-dichloro-6-ethyl-2-pyridin-3-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine?
4,5-dichloro-6-ethyl-2-pyridin-3-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine has a molecular weight of 325.22 g/mol, XLogP of 4.37, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-6-ethyl-2-pyridin-3-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 71719999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).