C17H15NO4S — CID 71720014
4-[2-(3,5-dimethoxyphenyl)-1,3-thiazol-4-yl]benzene-1,3-diol (PubChem CID 71720014) has the molecular formula C17H15NO4S and a molecular weight of 329.38 g/mol. Its IUPAC name is 4-[2-(3,5-dimethoxyphenyl)-1,3-thiazol-4-yl]benzene-1,3-diol.
| Compound Name | 4-[2-(3,5-dimethoxyphenyl)-1,3-thiazol-4-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 71720014 |
| Molecular Formula | C17H15NO4S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 4-[2-(3,5-dimethoxyphenyl)-1,3-thiazol-4-yl]benzene-1,3-diol |
| SMILES | COc1cc(OC)cc(-c2nc(-c3ccc(O)cc3O)cs2)c1 |
| InChI | InChI=1S/C17H15NO4S/c1-21-12-5-10(6-13(8-12)22-2)17-18-15(9-23-17)14-4-3-11(19)7-16(14)20/h3-9,19-20H,1-2H3 |
| InChIKey | IWJSKEHWBATNQN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |