C17H24O3 — CID 71720025
[(1R,2E,6E,10R,11S)-3-formyl-7,11-dimethyl-11-bicyclo[8.1.0]undeca-2,6-dienyl]methyl acetate (PubChem CID 71720025) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is [(1R,2E,6E,10R,11S)-3-formyl-7,11-dimethyl-11-bicyclo[8.1.0]undeca-2,6-dienyl]methyl acetate.
| Compound Name | [(1R,2E,6E,10R,11S)-3-formyl-7,11-dimethyl-11-bicyclo[8.1.0]undeca-2,6-dienyl]methyl acetate |
|---|---|
| PubChem CID | 71720025 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | [(1R,2E,6E,10R,11S)-3-formyl-7,11-dimethyl-11-bicyclo[8.1.0]undeca-2,6-dienyl]methyl acetate |
| SMILES | CC(=O)OC[C@]1(C)[C@@H]2/C=C(/C=O)CC/C=C(\C)CC[C@H]21 |
| InChI | InChI=1S/C17H24O3/c1-12-5-4-6-14(10-18)9-16-15(8-7-12)17(16,3)11-20-13(2)19/h5,9-10,15-16H,4,6-8,11H2,1-3H3/b12-5+,14-9+/t15-,16-,17+/m1/s1 |
| InChIKey | RBYAXSDAQKDGTH-AMXQQSCXSA-N |
| XLogP | 3.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|