C30H43N7O3 — CID 71720075
(2S)-N-[(2S)-6-amino-1-[4-(diaminomethylideneamino)butylamino]-1-oxohexan-2-yl]-1-[2-oxo-2-(4-phenylphenyl)ethyl]pyrrolidine-2-carboxamide (PubChem CID 71720075) has the molecular formula C30H43N7O3 and a molecular weight of 549.72 g/mol. Its IUPAC name is (2S)-N-[(2S)-6-amino-1-[4-(diaminomethylideneamino)butylamino]-1-oxohexan-2-yl]-1-[2-oxo-2-(4-phenylphenyl)ethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2S)-6-amino-1-[4-(diaminomethylideneamino)butylamino]-1-oxohexan-2-yl]-1-[2-oxo-2-(4-phenylphenyl)ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 71720075 |
| Molecular Formula | C30H43N7O3 |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.34 |
| IUPAC Name | (2S)-N-[(2S)-6-amino-1-[4-(diaminomethylideneamino)butylamino]-1-oxohexan-2-yl]-1-[2-oxo-2-(4-phenylphenyl)ethyl]pyrrolidine-2-carboxamide |
| SMILES | NCCCC[C@H](NC(=O)[C@@H]1CCCN1CC(=O)c1ccc(-c2ccccc2)cc1)C(=O)NCCCCN=C(N)N |
| InChI | InChI=1S/C30H43N7O3/c31-17-5-4-11-25(28(39)34-18-6-7-19-35-30(32)33)36-29(40)26-12-8-20-37(26)21-27(38)24-15-13-23(14-16-24)22-9-2-1-3-10-22/h1-3,9-10,13-16,25-26H,4-8,11-12,17-21,31H2,(H,34,39)(H,36,40)(H4,32,33,35)/t25-,26-/m0/s1 |
| InChIKey | IBGNMHXKSAZSSZ-UIOOFZCWSA-N |
| XLogP | 1.78 |
| TPSA | 168.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|