About 4-triethylsilylphenol
4-triethylsilylphenol (PubChem CID 71720369) has the molecular formula C12H20OSi
and a molecular weight of 208.38 g/mol. Its IUPAC name is 4-triethylsilylphenol.
Molecular Properties
| Compound Name | 4-triethylsilylphenol |
| PubChem CID | 71720369 |
| Molecular Formula | C12H20OSi |
| Molecular Weight | 208.38 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 4-triethylsilylphenol |
| SMILES | CC[Si](CC)(CC)c1ccc(O)cc1 |
| InChI | InChI=1S/C12H20OSi/c1-4-14(5-2,6-3)12-9-7-11(13)8-10-12/h7-10,13H,4-6H2,1-3H3 |
| InChIKey | QQZNAHGCLIXTFM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-triethylsilylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-triethylsilylphenol?
The IUPAC name of 4-triethylsilylphenol (CID 71720369) is 4-triethylsilylphenol.
What is the SMILES notation for 4-triethylsilylphenol?
The canonical SMILES for 4-triethylsilylphenol is CC[Si](CC)(CC)c1ccc(O)cc1.
What is the InChIKey of 4-triethylsilylphenol?
The InChIKey is QQZNAHGCLIXTFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20OSi/c1-4-14(5-2,6-3)12-9-7-11(13)8-10-12/h7-10,13H,4-6H2,1-3H3.
What are the key properties of 4-triethylsilylphenol?
4-triethylsilylphenol has a molecular weight of 208.38 g/mol, XLogP of 3.11, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-triethylsilylphenol is sourced from PubChem (CID 71720369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).