C9H10O4 — CID 7172046
2-hydroxy-3,5-dimethoxybenzaldehyde (PubChem CID 7172046) has the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. Its IUPAC name is 2-hydroxy-3,5-dimethoxybenzaldehyde.
| Compound Name | 2-hydroxy-3,5-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 7172046 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 2-hydroxy-3,5-dimethoxybenzaldehyde |
| SMILES | COc1cc(C=O)c(O)c(OC)c1 |
| InChI | InChI=1S/C9H10O4/c1-12-7-3-6(5-10)9(11)8(4-7)13-2/h3-5,11H,1-2H3 |
| InChIKey | RZKNKVRCIXKLBQ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|