C14H20F2O2 — CID 71720467
(5E,10E,12E)-8,8-difluoro-9-hydroxytetradeca-5,10,12-trien-7-one (PubChem CID 71720467) has the molecular formula C14H20F2O2 and a molecular weight of 258.31 g/mol. Its IUPAC name is (5E,10E,12E)-8,8-difluoro-9-hydroxytetradeca-5,10,12-trien-7-one.
| Compound Name | (5E,10E,12E)-8,8-difluoro-9-hydroxytetradeca-5,10,12-trien-7-one |
|---|---|
| PubChem CID | 71720467 |
| Molecular Formula | C14H20F2O2 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | (5E,10E,12E)-8,8-difluoro-9-hydroxytetradeca-5,10,12-trien-7-one |
| SMILES | C/C=C/C=C/C(O)C(F)(F)C(=O)/C=C/CCCC |
| InChI | InChI=1S/C14H20F2O2/c1-3-5-7-9-11-13(18)14(15,16)12(17)10-8-6-4-2/h4,6,8-12,17H,3,5,7H2,1-2H3/b6-4+,10-8+,11-9+ |
| InChIKey | FKGFOFXDSNOJEH-CUEVNBJKSA-N |
| XLogP | 3.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|