C18H34O4 — CID 71720654
methyl (Z,3S)-4,6-diethyl-3,6-dihydroxy-8-methyldodec-4-enoate (PubChem CID 71720654) has the molecular formula C18H34O4 and a molecular weight of 314.47 g/mol. Its IUPAC name is methyl (Z,3S)-4,6-diethyl-3,6-dihydroxy-8-methyldodec-4-enoate.
| Compound Name | methyl (Z,3S)-4,6-diethyl-3,6-dihydroxy-8-methyldodec-4-enoate |
|---|---|
| PubChem CID | 71720654 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | methyl (Z,3S)-4,6-diethyl-3,6-dihydroxy-8-methyldodec-4-enoate |
| SMILES | CCCCC(C)CC(O)(/C=C(/CC)[C@@H](O)CC(=O)OC)CC |
| InChI | InChI=1S/C18H34O4/c1-6-9-10-14(4)12-18(21,8-3)13-15(7-2)16(19)11-17(20)22-5/h13-14,16,19,21H,6-12H2,1-5H3/b15-13-/t14?,16-,18?/m0/s1 |
| InChIKey | OVELAJGOVXIXTI-FAVBXDADSA-N |
| XLogP | 3.60 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|