C18H29N3O5 — CID 71720660
N-[6-[(2R,3S,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]pyridine-3-carboxamide (PubChem CID 71720660) has the molecular formula C18H29N3O5 and a molecular weight of 367.45 g/mol. Its IUPAC name is N-[6-[(2R,3S,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]pyridine-3-carboxamide.
| Compound Name | N-[6-[(2R,3S,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 71720660 |
| Molecular Formula | C18H29N3O5 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | N-[6-[(2R,3S,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCCCCCN1C[C@H](O)[C@@H](O)[C@@H](O)[C@H]1CO)c1cccnc1 |
| InChI | InChI=1S/C18H29N3O5/c22-12-14-16(24)17(25)15(23)11-21(14)9-4-2-1-3-8-20-18(26)13-6-5-7-19-10-13/h5-7,10,14-17,22-25H,1-4,8-9,11-12H2,(H,20,26)/t14-,15+,16+,17-/m1/s1 |
| InChIKey | QPQNBTILANJKCC-LTIDMASMSA-N |
| XLogP | -0.87 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|